C24H23N2O2+ — CID 90950679
2-(1,2-dimethylindol-1-ium-3-ylidene)-4-(1,2-dimethylindol-3-yl)-3-hydroxycyclobutan-1-one (PubChem CID 90950679) has the molecular formula C24H23N2O2+ and a molecular weight of 371.46 g/mol. Its IUPAC name is 2-(1,2-dimethylindol-1-ium-3-ylidene)-4-(1,2-dimethylindol-3-yl)-3-hydroxycyclobutan-1-one.
| Compound Name | 2-(1,2-dimethylindol-1-ium-3-ylidene)-4-(1,2-dimethylindol-3-yl)-3-hydroxycyclobutan-1-one |
|---|---|
| PubChem CID | 90950679 |
| Molecular Formula | C24H23N2O2+ |
| Molecular Weight | 371.46 g/mol |
| Exact Mass | 371.18 |
| IUPAC Name | 2-(1,2-dimethylindol-1-ium-3-ylidene)-4-(1,2-dimethylindol-3-yl)-3-hydroxycyclobutan-1-one |
| SMILES | CC1=[N+](C)c2ccccc2C1=C1C(=O)C(c2c(C)n(C)c3ccccc23)C1O |
| InChI | InChI=1S/C24H23N2O2/c1-13-19(15-9-5-7-11-17(15)25(13)3)21-23(27)22(24(21)28)20-14(2)26(4)18-12-8-6-10-16(18)20/h5-12,21,23,27H,1-4H3/q+1 |
| InChIKey | OOBQVEJHUGPZMA-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 45.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.46 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|