C12H19N — CID 142183701
ethane;N-[(2E,4Z)-4-ethenylhepta-2,4,6-trien-3-yl]methanimine (PubChem CID 142183701) has the molecular formula C12H19N and a molecular weight of 177.29 g/mol. Its IUPAC name is ethane;N-[(2E,4Z)-4-ethenylhepta-2,4,6-trien-3-yl]methanimine.
| Compound Name | ethane;N-[(2E,4Z)-4-ethenylhepta-2,4,6-trien-3-yl]methanimine |
|---|---|
| PubChem CID | 142183701 |
| Molecular Formula | C12H19N |
| Molecular Weight | 177.29 g/mol |
| Exact Mass | 177.15 |
| IUPAC Name | ethane;N-[(2E,4Z)-4-ethenylhepta-2,4,6-trien-3-yl]methanimine |
| SMILES | C=C/C=C(C=C)\C(=C/C)N=C.CC |
| InChI | InChI=1S/C10H13N.C2H6/c1-5-8-9(6-2)10(7-3)11-4;1-2/h5-8H,1-2,4H2,3H3;1-2H3/b9-8-,10-7+; |
| InChIKey | SEYKPORHEFQUSP-ZTOBHTJDSA-N |
| XLogP | 3.92 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.29 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|