C40H48N4 — CID 142185535
ethane;18-methyl-7-[(1E,3Z,5Z)-4-methylhepta-1,3,5-trienyl]-13,15-dimethylidene-12-(4-methylphenyl)-14,20,21,22-tetrazatetracyclo[15.2.1.13,6.18,11]docosa-1(20),2,4,6,8(21),9,11,16-octaene (PubChem CID 142185535) has the molecular formula C40H48N4 and a molecular weight of 584.85 g/mol. Its IUPAC name is ethane;18-methyl-7-[(1E,3Z,5Z)-4-methylhepta-1,3,5-trienyl]-13,15-dimethylidene-12-(4-methylphenyl)-14,20,21,22-tetrazatetracyclo[15.2.1.13,6.18,11]docosa-1(20),2,4,6,8(21),9,11,16-octaene.
| Compound Name | ethane;18-methyl-7-[(1E,3Z,5Z)-4-methylhepta-1,3,5-trienyl]-13,15-dimethylidene-12-(4-methylphenyl)-14,20,21,22-tetrazatetracyclo[15.2.1.13,6.18,11]docosa-1(20),2,4,6,8(21),9,11,16-octaene |
|---|---|
| PubChem CID | 142185535 |
| Molecular Formula | C40H48N4 |
| Molecular Weight | 584.85 g/mol |
| Exact Mass | 584.39 |
| IUPAC Name | ethane;18-methyl-7-[(1E,3Z,5Z)-4-methylhepta-1,3,5-trienyl]-13,15-dimethylidene-12-(4-methylphenyl)-14,20,21,22-tetrazatetracyclo[15.2.1.13,6.18,11]docosa-1(20),2,4,6,8(21),9,11,16-octaene |
| SMILES | C=c1cc2nc(cc3ccc([nH]3)c(/C=C/C=C(C)\C=C/C)c3nc(c(-c4ccc(C)cc4)c(=C)[nH]1)C=C3)CC2C.CC.CC |
| InChI | InChI=1S/C36H36N4.2C2H6/c1-7-9-23(2)10-8-11-31-32-17-16-29(38-32)22-30-20-25(4)35(39-30)21-26(5)37-27(6)36(34-19-18-33(31)40-34)28-14-12-24(3)13-15-28;2*1-2/h7-19,21-22,25,37-38H,5-6,20H2,1-4H3;2*1-2H3/b9-7-,11-8+,23-10-,29-22-,32-31-,35-21+,36-34+;; |
| InChIKey | MVBRUBWKXVOVKH-WUAXFVSESA-N |
| XLogP | 9.62 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.85 |
| LogP ≤ 5 | 9.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|