C24H31N2O6PS — CID 142185869
4-[[4-[2-[[2-(4-methoxyphenyl)acetyl]amino]ethoxy]phenyl]sulfanyl-methylphosphoryl]oxane-4-carboxamide (PubChem CID 142185869) has the molecular formula C24H31N2O6PS and a molecular weight of 506.56 g/mol. Its IUPAC name is 4-[[4-[2-[[2-(4-methoxyphenyl)acetyl]amino]ethoxy]phenyl]sulfanyl-methylphosphoryl]oxane-4-carboxamide.
| Compound Name | 4-[[4-[2-[[2-(4-methoxyphenyl)acetyl]amino]ethoxy]phenyl]sulfanyl-methylphosphoryl]oxane-4-carboxamide |
|---|---|
| PubChem CID | 142185869 |
| Molecular Formula | C24H31N2O6PS |
| Molecular Weight | 506.56 g/mol |
| Exact Mass | 506.16 |
| IUPAC Name | 4-[[4-[2-[[2-(4-methoxyphenyl)acetyl]amino]ethoxy]phenyl]sulfanyl-methylphosphoryl]oxane-4-carboxamide |
| SMILES | COc1ccc(CC(=O)NCCOc2ccc(SP(C)(=O)C3(C(N)=O)CCOCC3)cc2)cc1 |
| InChI | InChI=1S/C24H31N2O6PS/c1-30-19-5-3-18(4-6-19)17-22(27)26-13-16-32-20-7-9-21(10-8-20)34-33(2,29)24(23(25)28)11-14-31-15-12-24/h3-10H,11-17H2,1-2H3,(H2,25,28)(H,26,27) |
| InChIKey | JBPMSRJMNCNDMX-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 116.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.56 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|