C26H29N2O4PS — CID 142895658
4-[methyl-[4-[2-(3-pyridin-4-ylphenyl)ethoxy]phenyl]sulfanylphosphoryl]oxane-4-carboxamide (PubChem CID 142895658) has the molecular formula C26H29N2O4PS and a molecular weight of 496.57 g/mol. Its IUPAC name is 4-[methyl-[4-[2-(3-pyridin-4-ylphenyl)ethoxy]phenyl]sulfanylphosphoryl]oxane-4-carboxamide.
| Compound Name | 4-[methyl-[4-[2-(3-pyridin-4-ylphenyl)ethoxy]phenyl]sulfanylphosphoryl]oxane-4-carboxamide |
|---|---|
| PubChem CID | 142895658 |
| Molecular Formula | C26H29N2O4PS |
| Molecular Weight | 496.57 g/mol |
| Exact Mass | 496.16 |
| IUPAC Name | 4-[methyl-[4-[2-(3-pyridin-4-ylphenyl)ethoxy]phenyl]sulfanylphosphoryl]oxane-4-carboxamide |
| SMILES | CP(=O)(Sc1ccc(OCCc2cccc(-c3ccncc3)c2)cc1)C1(C(N)=O)CCOCC1 |
| InChI | InChI=1S/C26H29N2O4PS/c1-33(30,26(25(27)29)12-17-31-18-13-26)34-24-7-5-23(6-8-24)32-16-11-20-3-2-4-22(19-20)21-9-14-28-15-10-21/h2-10,14-15,19H,11-13,16-18H2,1H3,(H2,27,29) |
| InChIKey | TYGCXDNRSOAPOK-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 91.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.57 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|