C25H34NO7PS — CID 142186180
4-[[4-[3-[(3,5-dimethoxyphenyl)methoxy]propoxy]phenyl]sulfanyl-methylphosphoryl]oxane-4-carboxamide (PubChem CID 142186180) has the molecular formula C25H34NO7PS and a molecular weight of 523.59 g/mol. Its IUPAC name is 4-[[4-[3-[(3,5-dimethoxyphenyl)methoxy]propoxy]phenyl]sulfanyl-methylphosphoryl]oxane-4-carboxamide.
| Compound Name | 4-[[4-[3-[(3,5-dimethoxyphenyl)methoxy]propoxy]phenyl]sulfanyl-methylphosphoryl]oxane-4-carboxamide |
|---|---|
| PubChem CID | 142186180 |
| Molecular Formula | C25H34NO7PS |
| Molecular Weight | 523.59 g/mol |
| Exact Mass | 523.18 |
| IUPAC Name | 4-[[4-[3-[(3,5-dimethoxyphenyl)methoxy]propoxy]phenyl]sulfanyl-methylphosphoryl]oxane-4-carboxamide |
| SMILES | COc1cc(COCCCOc2ccc(SP(C)(=O)C3(C(N)=O)CCOCC3)cc2)cc(OC)c1 |
| InChI | InChI=1S/C25H34NO7PS/c1-29-21-15-19(16-22(17-21)30-2)18-32-11-4-12-33-20-5-7-23(8-6-20)35-34(3,28)25(24(26)27)9-13-31-14-10-25/h5-8,15-17H,4,9-14,18H2,1-3H3,(H2,26,27) |
| InChIKey | QVOZDKJQCWPDPZ-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 106.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.59 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|