C22H25N2O5PS2 — CID 142185876
4-[[4-[2-(1,3-benzoxazol-2-ylsulfanyl)ethoxy]phenyl]sulfanyl-methylphosphoryl]oxane-4-carboxamide (PubChem CID 142185876) has the molecular formula C22H25N2O5PS2 and a molecular weight of 492.56 g/mol. Its IUPAC name is 4-[[4-[2-(1,3-benzoxazol-2-ylsulfanyl)ethoxy]phenyl]sulfanyl-methylphosphoryl]oxane-4-carboxamide.
| Compound Name | 4-[[4-[2-(1,3-benzoxazol-2-ylsulfanyl)ethoxy]phenyl]sulfanyl-methylphosphoryl]oxane-4-carboxamide |
|---|---|
| PubChem CID | 142185876 |
| Molecular Formula | C22H25N2O5PS2 |
| Molecular Weight | 492.56 g/mol |
| Exact Mass | 492.09 |
| IUPAC Name | 4-[[4-[2-(1,3-benzoxazol-2-ylsulfanyl)ethoxy]phenyl]sulfanyl-methylphosphoryl]oxane-4-carboxamide |
| SMILES | CP(=O)(Sc1ccc(OCCSc2nc3ccccc3o2)cc1)C1(C(N)=O)CCOCC1 |
| InChI | InChI=1S/C22H25N2O5PS2/c1-30(26,22(20(23)25)10-12-27-13-11-22)32-17-8-6-16(7-9-17)28-14-15-31-21-24-18-4-2-3-5-19(18)29-21/h2-9H,10-15H2,1H3,(H2,23,25) |
| InChIKey | ZFFLMGSESSVMKA-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 104.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.56 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|