C23H28NO4PS — CID 142186300
4-[methyl-[4-[(E)-2-methyl-3-phenylprop-2-enoxy]phenyl]sulfanylphosphoryl]oxane-4-carboxamide (PubChem CID 142186300) has the molecular formula C23H28NO4PS and a molecular weight of 445.52 g/mol. Its IUPAC name is 4-[methyl-[4-[(E)-2-methyl-3-phenylprop-2-enoxy]phenyl]sulfanylphosphoryl]oxane-4-carboxamide.
| Compound Name | 4-[methyl-[4-[(E)-2-methyl-3-phenylprop-2-enoxy]phenyl]sulfanylphosphoryl]oxane-4-carboxamide |
|---|---|
| PubChem CID | 142186300 |
| Molecular Formula | C23H28NO4PS |
| Molecular Weight | 445.52 g/mol |
| Exact Mass | 445.15 |
| IUPAC Name | 4-[methyl-[4-[(E)-2-methyl-3-phenylprop-2-enoxy]phenyl]sulfanylphosphoryl]oxane-4-carboxamide |
| SMILES | C/C(=C\c1ccccc1)COc1ccc(SP(C)(=O)C2(C(N)=O)CCOCC2)cc1 |
| InChI | InChI=1S/C23H28NO4PS/c1-18(16-19-6-4-3-5-7-19)17-28-20-8-10-21(11-9-20)30-29(2,26)23(22(24)25)12-14-27-15-13-23/h3-11,16H,12-15,17H2,1-2H3,(H2,24,25)/b18-16+ |
| InChIKey | OUTWYZBCECBNRU-FBMGVBCBSA-N |
| XLogP | 5.20 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.52 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|