C30H35N2O4PS — CID 142895896
4-[methyl-[4-[4-[(4-phenylbenzoyl)amino]butyl]phenyl]sulfanylphosphoryl]oxane-4-carboxamide (PubChem CID 142895896) has the molecular formula C30H35N2O4PS and a molecular weight of 550.66 g/mol. Its IUPAC name is 4-[methyl-[4-[4-[(4-phenylbenzoyl)amino]butyl]phenyl]sulfanylphosphoryl]oxane-4-carboxamide.
| Compound Name | 4-[methyl-[4-[4-[(4-phenylbenzoyl)amino]butyl]phenyl]sulfanylphosphoryl]oxane-4-carboxamide |
|---|---|
| PubChem CID | 142895896 |
| Molecular Formula | C30H35N2O4PS |
| Molecular Weight | 550.66 g/mol |
| Exact Mass | 550.21 |
| IUPAC Name | 4-[methyl-[4-[4-[(4-phenylbenzoyl)amino]butyl]phenyl]sulfanylphosphoryl]oxane-4-carboxamide |
| SMILES | CP(=O)(Sc1ccc(CCCCNC(=O)c2ccc(-c3ccccc3)cc2)cc1)C1(C(N)=O)CCOCC1 |
| InChI | InChI=1S/C30H35N2O4PS/c1-37(35,30(29(31)34)18-21-36-22-19-30)38-27-16-10-23(11-17-27)7-5-6-20-32-28(33)26-14-12-25(13-15-26)24-8-3-2-4-9-24/h2-4,8-17H,5-7,18-22H2,1H3,(H2,31,34)(H,32,33) |
| InChIKey | KXTJPBIPIAYNMG-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.66 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|