C30H35N2O5PS — CID 142186420
4-[[4-[3-[(4-cyclohepta-1,4,6-trien-1-ylbenzoyl)amino]propoxy]phenyl]sulfanyl-methylphosphoryl]oxane-4-carboxamide (PubChem CID 142186420) has the molecular formula C30H35N2O5PS and a molecular weight of 566.66 g/mol. Its IUPAC name is 4-[[4-[3-[(4-cyclohepta-1,4,6-trien-1-ylbenzoyl)amino]propoxy]phenyl]sulfanyl-methylphosphoryl]oxane-4-carboxamide.
| Compound Name | 4-[[4-[3-[(4-cyclohepta-1,4,6-trien-1-ylbenzoyl)amino]propoxy]phenyl]sulfanyl-methylphosphoryl]oxane-4-carboxamide |
|---|---|
| PubChem CID | 142186420 |
| Molecular Formula | C30H35N2O5PS |
| Molecular Weight | 566.66 g/mol |
| Exact Mass | 566.20 |
| IUPAC Name | 4-[[4-[3-[(4-cyclohepta-1,4,6-trien-1-ylbenzoyl)amino]propoxy]phenyl]sulfanyl-methylphosphoryl]oxane-4-carboxamide |
| SMILES | CP(=O)(Sc1ccc(OCCCNC(=O)c2ccc(C3=CCC=CC=C3)cc2)cc1)C1(C(N)=O)CCOCC1 |
| InChI | InChI=1S/C30H35N2O5PS/c1-38(35,30(29(31)34)17-21-36-22-18-30)39-27-15-13-26(14-16-27)37-20-6-19-32-28(33)25-11-9-24(10-12-25)23-7-4-2-3-5-8-23/h2-4,7-16H,5-6,17-22H2,1H3,(H2,31,34)(H,32,33) |
| InChIKey | CBTIWOMDECJEIC-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 107.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.66 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|