C20H31NO5 — CID 140704596
[3-methoxy-5-(3-methoxypropoxy)phenyl]methyl N-tert-butyl-N-cyclopropylcarbamate (PubChem CID 140704596) has the molecular formula C20H31NO5 and a molecular weight of 365.47 g/mol. Its IUPAC name is [3-methoxy-5-(3-methoxypropoxy)phenyl]methyl N-tert-butyl-N-cyclopropylcarbamate.
| Compound Name | [3-methoxy-5-(3-methoxypropoxy)phenyl]methyl N-tert-butyl-N-cyclopropylcarbamate |
|---|---|
| PubChem CID | 140704596 |
| Molecular Formula | C20H31NO5 |
| Molecular Weight | 365.47 g/mol |
| Exact Mass | 365.22 |
| IUPAC Name | [3-methoxy-5-(3-methoxypropoxy)phenyl]methyl N-tert-butyl-N-cyclopropylcarbamate |
| SMILES | COCCCOc1cc(COC(=O)N(C2CC2)C(C)(C)C)cc(OC)c1 |
| InChI | InChI=1S/C20H31NO5/c1-20(2,3)21(16-7-8-16)19(22)26-14-15-11-17(24-5)13-18(12-15)25-10-6-9-23-4/h11-13,16H,6-10,14H2,1-5H3 |
| InChIKey | OHUITUPTQFZVMS-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.47 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|