C21H35NO4 — CID 118457752
N-[1-[3-methoxy-5-(3-methoxypropoxy)phenyl]ethyl]-N-[(2-methylpropan-2-yl)oxymethyl]cyclopropanamine (PubChem CID 118457752) has the molecular formula C21H35NO4 and a molecular weight of 365.51 g/mol. Its IUPAC name is N-[1-[3-methoxy-5-(3-methoxypropoxy)phenyl]ethyl]-N-[(2-methylpropan-2-yl)oxymethyl]cyclopropanamine.
| Compound Name | N-[1-[3-methoxy-5-(3-methoxypropoxy)phenyl]ethyl]-N-[(2-methylpropan-2-yl)oxymethyl]cyclopropanamine |
|---|---|
| PubChem CID | 118457752 |
| Molecular Formula | C21H35NO4 |
| Molecular Weight | 365.51 g/mol |
| Exact Mass | 365.26 |
| IUPAC Name | N-[1-[3-methoxy-5-(3-methoxypropoxy)phenyl]ethyl]-N-[(2-methylpropan-2-yl)oxymethyl]cyclopropanamine |
| SMILES | COCCCOc1cc(OC)cc(C(C)N(COC(C)(C)C)C2CC2)c1 |
| InChI | InChI=1S/C21H35NO4/c1-16(22(18-8-9-18)15-26-21(2,3)4)17-12-19(24-6)14-20(13-17)25-11-7-10-23-5/h12-14,16,18H,7-11,15H2,1-6H3 |
| InChIKey | UXOHTAIMIMTSEK-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.51 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|