C19H29N3O5S — CID 142185948
methyl 4-[4-[(4-carbamoyloxan-4-yl)-methylamino]sulfanyloxy-N-methylanilino]butanoate (PubChem CID 142185948) has the molecular formula C19H29N3O5S and a molecular weight of 411.52 g/mol. Its IUPAC name is methyl 4-[4-[(4-carbamoyloxan-4-yl)-methylamino]sulfanyloxy-N-methylanilino]butanoate.
| Compound Name | methyl 4-[4-[(4-carbamoyloxan-4-yl)-methylamino]sulfanyloxy-N-methylanilino]butanoate |
|---|---|
| PubChem CID | 142185948 |
| Molecular Formula | C19H29N3O5S |
| Molecular Weight | 411.52 g/mol |
| Exact Mass | 411.18 |
| IUPAC Name | methyl 4-[4-[(4-carbamoyloxan-4-yl)-methylamino]sulfanyloxy-N-methylanilino]butanoate |
| SMILES | COC(=O)CCCN(C)c1ccc(OSN(C)C2(C(N)=O)CCOCC2)cc1 |
| InChI | InChI=1S/C19H29N3O5S/c1-21(12-4-5-17(23)25-3)15-6-8-16(9-7-15)27-28-22(2)19(18(20)24)10-13-26-14-11-19/h6-9H,4-5,10-14H2,1-3H3,(H2,20,24) |
| InChIKey | MPHVOSYCQCCGAO-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 94.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.52 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|