C25H33N3O5S — CID 142186096
4-[methyl-[4-[3-[(5Z,8Z)-4-methylidene-7,10-dihydro-1,3-oxazecin-2-yl]propoxy]phenoxy]sulfanylamino]oxane-4-carboxamide (PubChem CID 142186096) has the molecular formula C25H33N3O5S and a molecular weight of 487.62 g/mol. Its IUPAC name is 4-[methyl-[4-[3-[(5Z,8Z)-4-methylidene-7,10-dihydro-1,3-oxazecin-2-yl]propoxy]phenoxy]sulfanylamino]oxane-4-carboxamide.
| Compound Name | 4-[methyl-[4-[3-[(5Z,8Z)-4-methylidene-7,10-dihydro-1,3-oxazecin-2-yl]propoxy]phenoxy]sulfanylamino]oxane-4-carboxamide |
|---|---|
| PubChem CID | 142186096 |
| Molecular Formula | C25H33N3O5S |
| Molecular Weight | 487.62 g/mol |
| Exact Mass | 487.21 |
| IUPAC Name | 4-[methyl-[4-[3-[(5Z,8Z)-4-methylidene-7,10-dihydro-1,3-oxazecin-2-yl]propoxy]phenoxy]sulfanylamino]oxane-4-carboxamide |
| SMILES | C=C1/C=C\C/C=C\CO/C(CCCOc2ccc(OSN(C)C3(C(N)=O)CCOCC3)cc2)=N/1 |
| InChI | InChI=1S/C25H33N3O5S/c1-20-8-5-3-4-6-16-32-23(27-20)9-7-17-31-21-10-12-22(13-11-21)33-34-28(2)25(24(26)29)14-18-30-19-15-25/h4-6,8,10-13H,1,3,7,9,14-19H2,2H3,(H2,26,29)/b6-4-,8-5-,27-23+ |
| InChIKey | CKVAFBYWNFGNQS-YGIHWUJDSA-N |
| XLogP | 4.20 |
| TPSA | 95.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.62 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|