C20H24F2N2OS — CID 142186632
1,3-difluorobenzene;N,N'-dimethylmethanimidamide;[(3Z)-penta-1,3-dien-2-yl]sulfinylbenzene (PubChem CID 142186632) has the molecular formula C20H24F2N2OS and a molecular weight of 378.49 g/mol. Its IUPAC name is 1,3-difluorobenzene;N,N'-dimethylmethanimidamide;[(3Z)-penta-1,3-dien-2-yl]sulfinylbenzene.
| Compound Name | 1,3-difluorobenzene;N,N'-dimethylmethanimidamide;[(3Z)-penta-1,3-dien-2-yl]sulfinylbenzene |
|---|---|
| PubChem CID | 142186632 |
| Molecular Formula | C20H24F2N2OS |
| Molecular Weight | 378.49 g/mol |
| Exact Mass | 378.16 |
| IUPAC Name | 1,3-difluorobenzene;N,N'-dimethylmethanimidamide;[(3Z)-penta-1,3-dien-2-yl]sulfinylbenzene |
| SMILES | C/N=C/NC.C=C(/C=C\C)S(=O)c1ccccc1.Fc1cccc(F)c1 |
| InChI | InChI=1S/C11H12OS.C6H4F2.C3H8N2/c1-3-7-10(2)13(12)11-8-5-4-6-9-11;7-5-2-1-3-6(8)4-5;1-4-3-5-2/h3-9H,2H2,1H3;1-4H;3H,1-2H3,(H,4,5)/b7-3-;; |
| InChIKey | ATLUNPRNMLHTBK-NAMRTZQUSA-N |
| XLogP | 4.71 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.49 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|