C19H26N2O3 — CID 142187181
5-[3-[[(5R)-3-bicyclo[3.2.1]octanyl]oxy]-4-methoxyphenyl]-1,3-diazinan-2-one (PubChem CID 142187181) has the molecular formula C19H26N2O3 and a molecular weight of 330.43 g/mol. Its IUPAC name is 5-[3-[[(5R)-3-bicyclo[3.2.1]octanyl]oxy]-4-methoxyphenyl]-1,3-diazinan-2-one.
| Compound Name | 5-[3-[[(5R)-3-bicyclo[3.2.1]octanyl]oxy]-4-methoxyphenyl]-1,3-diazinan-2-one |
|---|---|
| PubChem CID | 142187181 |
| Molecular Formula | C19H26N2O3 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.19 |
| IUPAC Name | 5-[3-[[(5R)-3-bicyclo[3.2.1]octanyl]oxy]-4-methoxyphenyl]-1,3-diazinan-2-one |
| SMILES | COc1ccc(C2CNC(=O)NC2)cc1OC1CC2CC[C@H](C2)C1 |
| InChI | InChI=1S/C19H26N2O3/c1-23-17-5-4-14(15-10-20-19(22)21-11-15)9-18(17)24-16-7-12-2-3-13(6-12)8-16/h4-5,9,12-13,15-16H,2-3,6-8,10-11H2,1H3,(H2,20,21,22)/t12-,13?,16?/m1/s1 |
| InChIKey | WZCBOMZZVASCED-VEAWUBTESA-N |
| XLogP | 3.05 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |