C17H26Cl3N3O — CID 142187477
1-[[3-(aminomethyl)cyclohexyl]methyl]-3-(3,5-dichlorophenyl)urea;chloroethane (PubChem CID 142187477) has the molecular formula C17H26Cl3N3O and a molecular weight of 394.77 g/mol. Its IUPAC name is 1-[[3-(aminomethyl)cyclohexyl]methyl]-3-(3,5-dichlorophenyl)urea;chloroethane.
| Compound Name | 1-[[3-(aminomethyl)cyclohexyl]methyl]-3-(3,5-dichlorophenyl)urea;chloroethane |
|---|---|
| PubChem CID | 142187477 |
| Molecular Formula | C17H26Cl3N3O |
| Molecular Weight | 394.77 g/mol |
| Exact Mass | 393.11 |
| IUPAC Name | 1-[[3-(aminomethyl)cyclohexyl]methyl]-3-(3,5-dichlorophenyl)urea;chloroethane |
| SMILES | CCCl.NCC1CCCC(CNC(=O)Nc2cc(Cl)cc(Cl)c2)C1 |
| InChI | InChI=1S/C15H21Cl2N3O.C2H5Cl/c16-12-5-13(17)7-14(6-12)20-15(21)19-9-11-3-1-2-10(4-11)8-18;1-2-3/h5-7,10-11H,1-4,8-9,18H2,(H2,19,20,21);2H2,1H3 |
| InChIKey | MTEZIFDSFQINEZ-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.77 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|