C18H24N2O3 — CID 142189719
4-pyridin-3-ylbutan-2-yl 1-(3-oxoprop-1-en-2-yl)piperidine-2-carboxylate (PubChem CID 142189719) has the molecular formula C18H24N2O3 and a molecular weight of 316.40 g/mol. Its IUPAC name is 4-pyridin-3-ylbutan-2-yl 1-(3-oxoprop-1-en-2-yl)piperidine-2-carboxylate.
| Compound Name | 4-pyridin-3-ylbutan-2-yl 1-(3-oxoprop-1-en-2-yl)piperidine-2-carboxylate |
|---|---|
| PubChem CID | 142189719 |
| Molecular Formula | C18H24N2O3 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.18 |
| IUPAC Name | 4-pyridin-3-ylbutan-2-yl 1-(3-oxoprop-1-en-2-yl)piperidine-2-carboxylate |
| SMILES | C=C(C=O)N1CCCCC1C(=O)OC(C)CCc1cccnc1 |
| InChI | InChI=1S/C18H24N2O3/c1-14(13-21)20-11-4-3-7-17(20)18(22)23-15(2)8-9-16-6-5-10-19-12-16/h5-6,10,12-13,15,17H,1,3-4,7-9,11H2,2H3 |
| InChIKey | HZHMYTWBUSOWDD-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|