C37H52N2O8 — CID 91151830
[(4R)-12-formyloxy-4,10-dimethyl-7-oxo-8-prop-2-enyl-1-pyridin-3-yldodec-8-en-3-yl] (2S)-1-[2-[(2R,4R)-2,4-dimethyloxolan-2-yl]-2-oxoacetyl]piperidine-2-carboxylate (PubChem CID 91151830) has the molecular formula C37H52N2O8 and a molecular weight of 652.83 g/mol. Its IUPAC name is [(4R)-12-formyloxy-4,10-dimethyl-7-oxo-8-prop-2-enyl-1-pyridin-3-yldodec-8-en-3-yl] (2S)-1-[2-[(2R,4R)-2,4-dimethyloxolan-2-yl]-2-oxoacetyl]piperidine-2-carboxylate.
| Compound Name | [(4R)-12-formyloxy-4,10-dimethyl-7-oxo-8-prop-2-enyl-1-pyridin-3-yldodec-8-en-3-yl] (2S)-1-[2-[(2R,4R)-2,4-dimethyloxolan-2-yl]-2-oxoacetyl]piperidine-2-carboxylate |
|---|---|
| PubChem CID | 91151830 |
| Molecular Formula | C37H52N2O8 |
| Molecular Weight | 652.83 g/mol |
| Exact Mass | 652.37 |
| IUPAC Name | [(4R)-12-formyloxy-4,10-dimethyl-7-oxo-8-prop-2-enyl-1-pyridin-3-yldodec-8-en-3-yl] (2S)-1-[2-[(2R,4R)-2,4-dimethyloxolan-2-yl]-2-oxoacetyl]piperidine-2-carboxylate |
| SMILES | C=CCC(=CC(C)CCOC=O)C(=O)CC[C@@H](C)C(CCc1cccnc1)OC(=O)[C@@H]1CCCCN1C(=O)C(=O)[C@@]1(C)C[C@@H](C)CO1 |
| InChI | InChI=1S/C37H52N2O8/c1-6-10-30(21-26(2)17-20-45-25-40)32(41)15-13-28(4)33(16-14-29-11-9-18-38-23-29)47-36(44)31-12-7-8-19-39(31)35(43)34(42)37(5)22-27(3)24-46-37/h6,9,11,18,21,23,25-28,31,33H,1,7-8,10,12-17,19-20,22,24H2,2-5H3/t26?,27-,28-,31+,33?,37-/m1/s1 |
| InChIKey | GRIXBALRXDYHNR-JHDUBEHSSA-N |
| XLogP | 5.38 |
| TPSA | 129.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.83 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|