C25H34O3 — CID 142190427
3-[(E)-5-[(8aR)-5,8a-dimethyl-4,4a,5,6,7,8-hexahydro-3H-naphthalen-1-yl]-3-methylpent-2-enyl]-4-hydroxybenzoic acid (PubChem CID 142190427) has the molecular formula C25H34O3 and a molecular weight of 382.54 g/mol. Its IUPAC name is 3-[(E)-5-[(8aR)-5,8a-dimethyl-4,4a,5,6,7,8-hexahydro-3H-naphthalen-1-yl]-3-methylpent-2-enyl]-4-hydroxybenzoic acid.
| Compound Name | 3-[(E)-5-[(8aR)-5,8a-dimethyl-4,4a,5,6,7,8-hexahydro-3H-naphthalen-1-yl]-3-methylpent-2-enyl]-4-hydroxybenzoic acid |
|---|---|
| PubChem CID | 142190427 |
| Molecular Formula | C25H34O3 |
| Molecular Weight | 382.54 g/mol |
| Exact Mass | 382.25 |
| IUPAC Name | 3-[(E)-5-[(8aR)-5,8a-dimethyl-4,4a,5,6,7,8-hexahydro-3H-naphthalen-1-yl]-3-methylpent-2-enyl]-4-hydroxybenzoic acid |
| SMILES | C/C(=C\Cc1cc(C(=O)O)ccc1O)CCC1=CCCC2C(C)CCC[C@@]12C |
| InChI | InChI=1S/C25H34O3/c1-17(9-11-19-16-20(24(27)28)12-14-23(19)26)10-13-21-7-4-8-22-18(2)6-5-15-25(21,22)3/h7,9,12,14,16,18,22,26H,4-6,8,10-11,13,15H2,1-3H3,(H,27,28)/b17-9+/t18?,22?,25-/m0/s1 |
| InChIKey | SBFFBILANIEVKE-WURLCMFTSA-N |
| XLogP | 6.52 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.54 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|