C25H27ClN4O7S — CID 142192715
tert-butyl 4-[4-[2-[[(5-chlorothiophene-2-carbonyl)amino]methyl]-6-oxomorpholin-4-yl]phenyl]-3,5-dioxopiperazine-1-carboxylate (PubChem CID 142192715) has the molecular formula C25H27ClN4O7S and a molecular weight of 563.03 g/mol. Its IUPAC name is tert-butyl 4-[4-[2-[[(5-chlorothiophene-2-carbonyl)amino]methyl]-6-oxomorpholin-4-yl]phenyl]-3,5-dioxopiperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-[2-[[(5-chlorothiophene-2-carbonyl)amino]methyl]-6-oxomorpholin-4-yl]phenyl]-3,5-dioxopiperazine-1-carboxylate |
|---|---|
| PubChem CID | 142192715 |
| Molecular Formula | C25H27ClN4O7S |
| Molecular Weight | 563.03 g/mol |
| Exact Mass | 562.13 |
| IUPAC Name | tert-butyl 4-[4-[2-[[(5-chlorothiophene-2-carbonyl)amino]methyl]-6-oxomorpholin-4-yl]phenyl]-3,5-dioxopiperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(=O)N(c2ccc(N3CC(=O)OC(CNC(=O)c4ccc(Cl)s4)C3)cc2)C(=O)C1 |
| InChI | InChI=1S/C25H27ClN4O7S/c1-25(2,3)37-24(35)29-12-20(31)30(21(32)13-29)16-6-4-15(5-7-16)28-11-17(36-22(33)14-28)10-27-23(34)18-8-9-19(26)38-18/h4-9,17H,10-14H2,1-3H3,(H,27,34) |
| InChIKey | ZZFZHBBOAFCWED-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 125.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.03 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|