C22H32N4O6 — CID 142197882
tert-butyl N-[(3R,4S)-1-(2-methoxyacetyl)-4-[[2-(4-methylanilino)-2-oxoacetyl]amino]piperidin-3-yl]carbamate (PubChem CID 142197882) has the molecular formula C22H32N4O6 and a molecular weight of 448.52 g/mol. Its IUPAC name is tert-butyl N-[(3R,4S)-1-(2-methoxyacetyl)-4-[[2-(4-methylanilino)-2-oxoacetyl]amino]piperidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3R,4S)-1-(2-methoxyacetyl)-4-[[2-(4-methylanilino)-2-oxoacetyl]amino]piperidin-3-yl]carbamate |
|---|---|
| PubChem CID | 142197882 |
| Molecular Formula | C22H32N4O6 |
| Molecular Weight | 448.52 g/mol |
| Exact Mass | 448.23 |
| IUPAC Name | tert-butyl N-[(3R,4S)-1-(2-methoxyacetyl)-4-[[2-(4-methylanilino)-2-oxoacetyl]amino]piperidin-3-yl]carbamate |
| SMILES | COCC(=O)N1CC[C@H](NC(=O)C(=O)Nc2ccc(C)cc2)[C@H](NC(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C22H32N4O6/c1-14-6-8-15(9-7-14)23-19(28)20(29)24-16-10-11-26(18(27)13-31-5)12-17(16)25-21(30)32-22(2,3)4/h6-9,16-17H,10-13H2,1-5H3,(H,23,28)(H,24,29)(H,25,30)/t16-,17+/m0/s1 |
| InChIKey | CAOAXHLXHXOYLF-DLBZAZTESA-N |
| XLogP | 1.19 |
| TPSA | 126.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.52 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|