C20H28ClN5O4 — CID 143305496
tert-butyl N-[(3R)-4-[[2-[(5-chloro-2-pyridinyl)amino]-2-oxoacetyl]amino]-1-prop-2-enylpiperidin-3-yl]carbamate (PubChem CID 143305496) has the molecular formula C20H28ClN5O4 and a molecular weight of 437.93 g/mol. Its IUPAC name is tert-butyl N-[(3R)-4-[[2-[(5-chloro-2-pyridinyl)amino]-2-oxoacetyl]amino]-1-prop-2-enylpiperidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3R)-4-[[2-[(5-chloro-2-pyridinyl)amino]-2-oxoacetyl]amino]-1-prop-2-enylpiperidin-3-yl]carbamate |
|---|---|
| PubChem CID | 143305496 |
| Molecular Formula | C20H28ClN5O4 |
| Molecular Weight | 437.93 g/mol |
| Exact Mass | 437.18 |
| IUPAC Name | tert-butyl N-[(3R)-4-[[2-[(5-chloro-2-pyridinyl)amino]-2-oxoacetyl]amino]-1-prop-2-enylpiperidin-3-yl]carbamate |
| SMILES | C=CCN1CCC(NC(=O)C(=O)Nc2ccc(Cl)cn2)[C@H](NC(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C20H28ClN5O4/c1-5-9-26-10-8-14(15(12-26)24-19(29)30-20(2,3)4)23-17(27)18(28)25-16-7-6-13(21)11-22-16/h5-7,11,14-15H,1,8-10,12H2,2-4H3,(H,23,27)(H,24,29)(H,22,25,28)/t14?,15-/m1/s1 |
| InChIKey | NXRKFFCNKLDNIA-YSSOQSIOSA-N |
| XLogP | 1.94 |
| TPSA | 112.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.93 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|