C21H25ClN4O4 — CID 45121529
tert-butyl N-[4-[(7-chloroisoquinoline-3-carbonyl)amino]-1-formylpiperidin-3-yl]carbamate (PubChem CID 45121529) has the molecular formula C21H25ClN4O4 and a molecular weight of 432.91 g/mol. Its IUPAC name is tert-butyl N-[4-[(7-chloroisoquinoline-3-carbonyl)amino]-1-formylpiperidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[4-[(7-chloroisoquinoline-3-carbonyl)amino]-1-formylpiperidin-3-yl]carbamate |
|---|---|
| PubChem CID | 45121529 |
| Molecular Formula | C21H25ClN4O4 |
| Molecular Weight | 432.91 g/mol |
| Exact Mass | 432.16 |
| IUPAC Name | tert-butyl N-[4-[(7-chloroisoquinoline-3-carbonyl)amino]-1-formylpiperidin-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CN(C=O)CCC1NC(=O)c1cc2ccc(Cl)cc2cn1 |
| InChI | InChI=1S/C21H25ClN4O4/c1-21(2,3)30-20(29)25-18-11-26(12-27)7-6-16(18)24-19(28)17-9-13-4-5-15(22)8-14(13)10-23-17/h4-5,8-10,12,16,18H,6-7,11H2,1-3H3,(H,24,28)(H,25,29) |
| InChIKey | GLKUITYIGALUSF-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.91 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|