About 1-[3-acetyl-5-(methylamino)phenyl]ethanone;ethyl 10-oxodecanoate
1-[3-acetyl-5-(methylamino)phenyl]ethanone;ethyl 10-oxodecanoate (PubChem CID 142204487) has the molecular formula C23H35NO5
and a molecular weight of 405.54 g/mol. Its IUPAC name is 1-[3-acetyl-5-(methylamino)phenyl]ethanone;ethyl 10-oxodecanoate.
Molecular Properties
| Compound Name | 1-[3-acetyl-5-(methylamino)phenyl]ethanone;ethyl 10-oxodecanoate |
| PubChem CID | 142204487 |
| Molecular Formula | C23H35NO5 |
| Molecular Weight | 405.54 g/mol |
| Exact Mass | 405.25 |
| IUPAC Name | 1-[3-acetyl-5-(methylamino)phenyl]ethanone;ethyl 10-oxodecanoate |
| SMILES | CCOC(=O)CCCCCCCCC=O.CNc1cc(C(C)=O)cc(C(C)=O)c1 |
| InChI | InChI=1S/C12H22O3.C11H13NO2/c1-2-15-12(14)10-8-6-4-3-5-7-9-11-13;1-7(13)9-4-10(8(2)14)6-11(5-9)12-3/h11H,2-10H2,1H3;4-6,12H,1-3H3 |
| InChIKey | HLPSMKRFWIMGSP-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 405.54 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-[3-acetyl-5-(methylamino)phenyl]ethanone;ethyl 10-oxodecanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3-acetyl-5-(methylamino)phenyl]ethanone;ethyl 10-oxodecanoate?
The IUPAC name of 1-[3-acetyl-5-(methylamino)phenyl]ethanone;ethyl 10-oxodecanoate (CID 142204487) is 1-[3-acetyl-5-(methylamino)phenyl]ethanone;ethyl 10-oxodecanoate.
What is the SMILES notation for 1-[3-acetyl-5-(methylamino)phenyl]ethanone;ethyl 10-oxodecanoate?
The canonical SMILES for 1-[3-acetyl-5-(methylamino)phenyl]ethanone;ethyl 10-oxodecanoate is CCOC(=O)CCCCCCCCC=O.CNc1cc(C(C)=O)cc(C(C)=O)c1.
What is the InChIKey of 1-[3-acetyl-5-(methylamino)phenyl]ethanone;ethyl 10-oxodecanoate?
The InChIKey is HLPSMKRFWIMGSP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22O3.C11H13NO2/c1-2-15-12(14)10-8-6-4-3-5-7-9-11-13;1-7(13)9-4-10(8(2)14)6-11(5-9)12-3/h11H,2-10H2,1H3;4-6,12H,1-3H3.
What are the key properties of 1-[3-acetyl-5-(methylamino)phenyl]ethanone;ethyl 10-oxodecanoate?
1-[3-acetyl-5-(methylamino)phenyl]ethanone;ethyl 10-oxodecanoate has a molecular weight of 405.54 g/mol, XLogP of 5.00, 13 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3-acetyl-5-(methylamino)phenyl]ethanone;ethyl 10-oxodecanoate is sourced from PubChem (CID 142204487), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).