C9H13NO — CID 142206585
4-(methylaminomethyl)cyclohepta-2,4,6-trien-1-ol (PubChem CID 142206585) has the molecular formula C9H13NO and a molecular weight of 151.21 g/mol. Its IUPAC name is 4-(methylaminomethyl)cyclohepta-2,4,6-trien-1-ol.
| Compound Name | 4-(methylaminomethyl)cyclohepta-2,4,6-trien-1-ol |
|---|---|
| PubChem CID | 142206585 |
| Molecular Formula | C9H13NO |
| Molecular Weight | 151.21 g/mol |
| Exact Mass | 151.10 |
| IUPAC Name | 4-(methylaminomethyl)cyclohepta-2,4,6-trien-1-ol |
| SMILES | CNCC1=CC=CC(O)C=C1 |
| InChI | InChI=1S/C9H13NO/c1-10-7-8-3-2-4-9(11)6-5-8/h2-6,9-11H,7H2,1H3 |
| InChIKey | CDZSQRDPNZQRQL-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.21 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |