C9H15NO — CID 142953251
(3Z,5Z)-4-(methylaminomethyl)hepta-1,3,5-trien-3-ol (PubChem CID 142953251) has the molecular formula C9H15NO and a molecular weight of 153.22 g/mol. Its IUPAC name is (3Z,5Z)-4-(methylaminomethyl)hepta-1,3,5-trien-3-ol.
| Compound Name | (3Z,5Z)-4-(methylaminomethyl)hepta-1,3,5-trien-3-ol |
|---|---|
| PubChem CID | 142953251 |
| Molecular Formula | C9H15NO |
| Molecular Weight | 153.22 g/mol |
| Exact Mass | 153.12 |
| IUPAC Name | (3Z,5Z)-4-(methylaminomethyl)hepta-1,3,5-trien-3-ol |
| SMILES | C=C/C(O)=C(\C=C/C)CNC |
| InChI | InChI=1S/C9H15NO/c1-4-6-8(7-10-3)9(11)5-2/h4-6,10-11H,2,7H2,1,3H3/b6-4-,9-8- |
| InChIKey | LMERHUOGFHYZDA-KDAARUEYSA-N |
| XLogP | 1.78 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.22 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|