C30H51N — CID 142209191
1-[4-(3,5-dimethylphenyl)cyclohex-3-en-1-yl]-6-methyl-2-propylhept-6-en-1-amine;ethane;prop-1-ene (PubChem CID 142209191) has the molecular formula C30H51N and a molecular weight of 425.75 g/mol. Its IUPAC name is 1-[4-(3,5-dimethylphenyl)cyclohex-3-en-1-yl]-6-methyl-2-propylhept-6-en-1-amine;ethane;prop-1-ene.
| Compound Name | 1-[4-(3,5-dimethylphenyl)cyclohex-3-en-1-yl]-6-methyl-2-propylhept-6-en-1-amine;ethane;prop-1-ene |
|---|---|
| PubChem CID | 142209191 |
| Molecular Formula | C30H51N |
| Molecular Weight | 425.75 g/mol |
| Exact Mass | 425.40 |
| IUPAC Name | 1-[4-(3,5-dimethylphenyl)cyclohex-3-en-1-yl]-6-methyl-2-propylhept-6-en-1-amine;ethane;prop-1-ene |
| SMILES | C=C(C)CCCC(CCC)C(N)C1CC=C(c2cc(C)cc(C)c2)CC1.C=CC.CC |
| InChI | InChI=1S/C25H39N.C3H6.C2H6/c1-6-8-22(10-7-9-18(2)3)25(26)23-13-11-21(12-14-23)24-16-19(4)15-20(5)17-24;1-3-2;1-2/h11,15-17,22-23,25H,2,6-10,12-14,26H2,1,3-5H3;3H,1H2,2H3;1-2H3 |
| InChIKey | XAFIZJMVKAQREY-UHFFFAOYSA-N |
| XLogP | 9.20 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.75 |
| LogP ≤ 5 | 9.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|