C23H36 — CID 142209296
1,3-dimethyl-5-[4-(2-propylhexyl)cyclohexen-1-yl]benzene (PubChem CID 142209296) has the molecular formula C23H36 and a molecular weight of 312.54 g/mol. Its IUPAC name is 1,3-dimethyl-5-[4-(2-propylhexyl)cyclohexen-1-yl]benzene.
| Compound Name | 1,3-dimethyl-5-[4-(2-propylhexyl)cyclohexen-1-yl]benzene |
|---|---|
| PubChem CID | 142209296 |
| Molecular Formula | C23H36 |
| Molecular Weight | 312.54 g/mol |
| Exact Mass | 312.28 |
| IUPAC Name | 1,3-dimethyl-5-[4-(2-propylhexyl)cyclohexen-1-yl]benzene |
| SMILES | CCCCC(CCC)CC1CC=C(c2cc(C)cc(C)c2)CC1 |
| InChI | InChI=1S/C23H36/c1-5-7-9-20(8-6-2)17-21-10-12-22(13-11-21)23-15-18(3)14-19(4)16-23/h12,14-16,20-21H,5-11,13,17H2,1-4H3 |
| InChIKey | SVIDRBRYCRBSNV-UHFFFAOYSA-N |
| XLogP | 7.48 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.54 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |