C32H33F3O2 — CID 67748685
1-[4-[4-[4-(4-but-3-enoxy-2,3-difluorophenyl)phenyl]-2-fluorophenyl]cyclohex-3-en-1-yl]butan-1-ol (PubChem CID 67748685) has the molecular formula C32H33F3O2 and a molecular weight of 506.61 g/mol. Its IUPAC name is 1-[4-[4-[4-(4-but-3-enoxy-2,3-difluorophenyl)phenyl]-2-fluorophenyl]cyclohex-3-en-1-yl]butan-1-ol.
| Compound Name | 1-[4-[4-[4-(4-but-3-enoxy-2,3-difluorophenyl)phenyl]-2-fluorophenyl]cyclohex-3-en-1-yl]butan-1-ol |
|---|---|
| PubChem CID | 67748685 |
| Molecular Formula | C32H33F3O2 |
| Molecular Weight | 506.61 g/mol |
| Exact Mass | 506.24 |
| IUPAC Name | 1-[4-[4-[4-(4-but-3-enoxy-2,3-difluorophenyl)phenyl]-2-fluorophenyl]cyclohex-3-en-1-yl]butan-1-ol |
| SMILES | C=CCCOc1ccc(-c2ccc(-c3ccc(C4=CCC(C(O)CCC)CC4)c(F)c3)cc2)c(F)c1F |
| InChI | InChI=1S/C32H33F3O2/c1-3-5-19-37-30-18-17-27(31(34)32(30)35)23-9-7-21(8-10-23)25-15-16-26(28(33)20-25)22-11-13-24(14-12-22)29(36)6-4-2/h3,7-11,15-18,20,24,29,36H,1,4-6,12-14,19H2,2H3 |
| InChIKey | KXIDTKVNQKFBBV-UHFFFAOYSA-N |
| XLogP | 8.74 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.61 |
| LogP ≤ 5 | 8.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|