C13H15N3OS — CID 142213573
(E)-N-[4-(methylaminomethyl)-1,3-thiazol-2-yl]-2-[(Z)-prop-1-enyl]pent-2-en-4-ynamide (PubChem CID 142213573) has the molecular formula C13H15N3OS and a molecular weight of 261.35 g/mol. Its IUPAC name is (E)-N-[4-(methylaminomethyl)-1,3-thiazol-2-yl]-2-[(Z)-prop-1-enyl]pent-2-en-4-ynamide.
| Compound Name | (E)-N-[4-(methylaminomethyl)-1,3-thiazol-2-yl]-2-[(Z)-prop-1-enyl]pent-2-en-4-ynamide |
|---|---|
| PubChem CID | 142213573 |
| Molecular Formula | C13H15N3OS |
| Molecular Weight | 261.35 g/mol |
| Exact Mass | 261.09 |
| IUPAC Name | (E)-N-[4-(methylaminomethyl)-1,3-thiazol-2-yl]-2-[(Z)-prop-1-enyl]pent-2-en-4-ynamide |
| SMILES | C#C/C=C(\C=C/C)C(=O)Nc1nc(CNC)cs1 |
| InChI | InChI=1S/C13H15N3OS/c1-4-6-10(7-5-2)12(17)16-13-15-11(8-14-3)9-18-13/h1,5-7,9,14H,8H2,2-3H3,(H,15,16,17)/b7-5-,10-6+ |
| InChIKey | OWROYVGSWOTVCI-ZPRNNRRZSA-N |
| XLogP | 1.94 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.35 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|