C9H9NO6 — CID 142216775
(3E)-5-methoxycarbonyl-2-methylidene-4-nitrohexa-3,5-dienoic acid (PubChem CID 142216775) has the molecular formula C9H9NO6 and a molecular weight of 227.17 g/mol. Its IUPAC name is (3E)-5-methoxycarbonyl-2-methylidene-4-nitrohexa-3,5-dienoic acid.
| Compound Name | (3E)-5-methoxycarbonyl-2-methylidene-4-nitrohexa-3,5-dienoic acid |
|---|---|
| PubChem CID | 142216775 |
| Molecular Formula | C9H9NO6 |
| Molecular Weight | 227.17 g/mol |
| Exact Mass | 227.04 |
| IUPAC Name | (3E)-5-methoxycarbonyl-2-methylidene-4-nitrohexa-3,5-dienoic acid |
| SMILES | C=C(/C=C(\C(=C)C(=O)OC)[N+](=O)[O-])C(=O)O |
| InChI | InChI=1S/C9H9NO6/c1-5(8(11)12)4-7(10(14)15)6(2)9(13)16-3/h4H,1-2H2,3H3,(H,11,12)/b7-4+ |
| InChIKey | IXCZVWPOZBATJT-QPJJXVBHSA-N |
| XLogP | 0.52 |
| TPSA | 106.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.17 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|