C33H47NO — CID 142217123
N-[(Z)-5-cyclooctylpent-2-en-3-yl]-1-(4-methylphenyl)ethanimine;1-(2-ethyl-6-methylphenyl)ethenol (PubChem CID 142217123) has the molecular formula C33H47NO and a molecular weight of 473.75 g/mol. Its IUPAC name is N-[(Z)-5-cyclooctylpent-2-en-3-yl]-1-(4-methylphenyl)ethanimine;1-(2-ethyl-6-methylphenyl)ethenol.
| Compound Name | N-[(Z)-5-cyclooctylpent-2-en-3-yl]-1-(4-methylphenyl)ethanimine;1-(2-ethyl-6-methylphenyl)ethenol |
|---|---|
| PubChem CID | 142217123 |
| Molecular Formula | C33H47NO |
| Molecular Weight | 473.75 g/mol |
| Exact Mass | 473.37 |
| IUPAC Name | N-[(Z)-5-cyclooctylpent-2-en-3-yl]-1-(4-methylphenyl)ethanimine;1-(2-ethyl-6-methylphenyl)ethenol |
| SMILES | C/C=C(CCC1CCCCCCC1)\N=C(/C)c1ccc(C)cc1.C=C(O)c1c(C)cccc1CC |
| InChI | InChI=1S/C22H33N.C11H14O/c1-4-22(17-14-20-10-8-6-5-7-9-11-20)23-19(3)21-15-12-18(2)13-16-21;1-4-10-7-5-6-8(2)11(10)9(3)12/h4,12-13,15-16,20H,5-11,14,17H2,1-3H3;5-7,12H,3-4H2,1-2H3/b22-4-,23-19+; |
| InChIKey | JSYZHHNFZPNLPF-VMWKVWDXSA-N |
| XLogP | 9.93 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.75 |
| LogP ≤ 5 | 9.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|