About tert-butyl 4-[5-cyano-2-(3,5-dichloroanilino)phenyl]sulfonylpiperazine-1-carboxylate;ethane
tert-butyl 4-[5-cyano-2-(3,5-dichloroanilino)phenyl]sulfonylpiperazine-1-carboxylate;ethane (PubChem CID 142219070) has the molecular formula C24H30Cl2N4O4S
and a molecular weight of 541.50 g/mol. Its IUPAC name is tert-butyl 4-[5-cyano-2-(3,5-dichloroanilino)phenyl]sulfonylpiperazine-1-carboxylate;ethane.
Molecular Properties
| Compound Name | tert-butyl 4-[5-cyano-2-(3,5-dichloroanilino)phenyl]sulfonylpiperazine-1-carboxylate;ethane |
| PubChem CID | 142219070 |
| Molecular Formula | C24H30Cl2N4O4S |
| Molecular Weight | 541.50 g/mol |
| Exact Mass | 540.14 |
| IUPAC Name | tert-butyl 4-[5-cyano-2-(3,5-dichloroanilino)phenyl]sulfonylpiperazine-1-carboxylate;ethane |
| SMILES | CC.CC(C)(C)OC(=O)N1CCN(S(=O)(=O)c2cc(C#N)ccc2Nc2cc(Cl)cc(Cl)c2)CC1 |
| InChI | InChI=1S/C22H24Cl2N4O4S.C2H6/c1-22(2,3)32-21(29)27-6-8-28(9-7-27)33(30,31)20-10-15(14-25)4-5-19(20)26-18-12-16(23)11-17(24)13-18;1-2/h4-5,10-13,26H,6-9H2,1-3H3;1-2H3 |
| InChIKey | WGGSVTNZWUXWDD-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 102.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 541.50 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze tert-butyl 4-[5-cyano-2-(3,5-dichloroanilino)phenyl]sulfonylpiperazine-1-carboxylate;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 4-[5-cyano-2-(3,5-dichloroanilino)phenyl]sulfonylpiperazine-1-carboxylate;ethane?
The IUPAC name of tert-butyl 4-[5-cyano-2-(3,5-dichloroanilino)phenyl]sulfonylpiperazine-1-carboxylate;ethane (CID 142219070) is tert-butyl 4-[5-cyano-2-(3,5-dichloroanilino)phenyl]sulfonylpiperazine-1-carboxylate;ethane.
What is the SMILES notation for tert-butyl 4-[5-cyano-2-(3,5-dichloroanilino)phenyl]sulfonylpiperazine-1-carboxylate;ethane?
The canonical SMILES for tert-butyl 4-[5-cyano-2-(3,5-dichloroanilino)phenyl]sulfonylpiperazine-1-carboxylate;ethane is CC.CC(C)(C)OC(=O)N1CCN(S(=O)(=O)c2cc(C#N)ccc2Nc2cc(Cl)cc(Cl)c2)CC1.
What is the InChIKey of tert-butyl 4-[5-cyano-2-(3,5-dichloroanilino)phenyl]sulfonylpiperazine-1-carboxylate;ethane?
The InChIKey is WGGSVTNZWUXWDD-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H24Cl2N4O4S.C2H6/c1-22(2,3)32-21(29)27-6-8-28(9-7-27)33(30,31)20-10-15(14-25)4-5-19(20)26-18-12-16(23)11-17(24)13-18;1-2/h4-5,10-13,26H,6-9H2,1-3H3;1-2H3.
What are the key properties of tert-butyl 4-[5-cyano-2-(3,5-dichloroanilino)phenyl]sulfonylpiperazine-1-carboxylate;ethane?
tert-butyl 4-[5-cyano-2-(3,5-dichloroanilino)phenyl]sulfonylpiperazine-1-carboxylate;ethane has a molecular weight of 541.50 g/mol, XLogP of 5.88, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 4-[5-cyano-2-(3,5-dichloroanilino)phenyl]sulfonylpiperazine-1-carboxylate;ethane is sourced from PubChem (CID 142219070), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).