About tert-butyl 4-[4-cyano-2-(3,5-dichloro-N-methylanilino)phenyl]sulfonylpiperazine-1-carboxylate
tert-butyl 4-[4-cyano-2-(3,5-dichloro-N-methylanilino)phenyl]sulfonylpiperazine-1-carboxylate (PubChem CID 90995513) has the molecular formula C23H26Cl2N4O4S
and a molecular weight of 525.46 g/mol. Its IUPAC name is tert-butyl 4-[4-cyano-2-(3,5-dichloro-N-methylanilino)phenyl]sulfonylpiperazine-1-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 4-[4-cyano-2-(3,5-dichloro-N-methylanilino)phenyl]sulfonylpiperazine-1-carboxylate |
| PubChem CID | 90995513 |
| Molecular Formula | C23H26Cl2N4O4S |
| Molecular Weight | 525.46 g/mol |
| Exact Mass | 524.11 |
| IUPAC Name | tert-butyl 4-[4-cyano-2-(3,5-dichloro-N-methylanilino)phenyl]sulfonylpiperazine-1-carboxylate |
| SMILES | CN(c1cc(Cl)cc(Cl)c1)c1cc(C#N)ccc1S(=O)(=O)N1CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C23H26Cl2N4O4S/c1-23(2,3)33-22(30)28-7-9-29(10-8-28)34(31,32)21-6-5-16(15-26)11-20(21)27(4)19-13-17(24)12-18(25)14-19/h5-6,11-14H,7-10H2,1-4H3 |
| InChIKey | QWMKKNBHGVWNPV-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 93.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 525.46 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze tert-butyl 4-[4-cyano-2-(3,5-dichloro-N-methylanilino)phenyl]sulfonylpiperazine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 4-[4-cyano-2-(3,5-dichloro-N-methylanilino)phenyl]sulfonylpiperazine-1-carboxylate?
The IUPAC name of tert-butyl 4-[4-cyano-2-(3,5-dichloro-N-methylanilino)phenyl]sulfonylpiperazine-1-carboxylate (CID 90995513) is tert-butyl 4-[4-cyano-2-(3,5-dichloro-N-methylanilino)phenyl]sulfonylpiperazine-1-carboxylate.
What is the SMILES notation for tert-butyl 4-[4-cyano-2-(3,5-dichloro-N-methylanilino)phenyl]sulfonylpiperazine-1-carboxylate?
The canonical SMILES for tert-butyl 4-[4-cyano-2-(3,5-dichloro-N-methylanilino)phenyl]sulfonylpiperazine-1-carboxylate is CN(c1cc(Cl)cc(Cl)c1)c1cc(C#N)ccc1S(=O)(=O)N1CCN(C(=O)OC(C)(C)C)CC1.
What is the InChIKey of tert-butyl 4-[4-cyano-2-(3,5-dichloro-N-methylanilino)phenyl]sulfonylpiperazine-1-carboxylate?
The InChIKey is QWMKKNBHGVWNPV-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H26Cl2N4O4S/c1-23(2,3)33-22(30)28-7-9-29(10-8-28)34(31,32)21-6-5-16(15-26)11-20(21)27(4)19-13-17(24)12-18(25)14-19/h5-6,11-14H,7-10H2,1-4H3.
What are the key properties of tert-butyl 4-[4-cyano-2-(3,5-dichloro-N-methylanilino)phenyl]sulfonylpiperazine-1-carboxylate?
tert-butyl 4-[4-cyano-2-(3,5-dichloro-N-methylanilino)phenyl]sulfonylpiperazine-1-carboxylate has a molecular weight of 525.46 g/mol, XLogP of 4.87, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 4-[4-cyano-2-(3,5-dichloro-N-methylanilino)phenyl]sulfonylpiperazine-1-carboxylate is sourced from PubChem (CID 90995513), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).