C21H38N2O6 — CID 142219387
tert-butyl N-[(6R,8aS)-2-amino-7,8-dihydroxy-6,7,8,8a-tetrahydro-4H-1,3-benzodioxin-6-yl]-N-octylcarbamate (PubChem CID 142219387) has the molecular formula C21H38N2O6 and a molecular weight of 414.54 g/mol. Its IUPAC name is tert-butyl N-[(6R,8aS)-2-amino-7,8-dihydroxy-6,7,8,8a-tetrahydro-4H-1,3-benzodioxin-6-yl]-N-octylcarbamate.
| Compound Name | tert-butyl N-[(6R,8aS)-2-amino-7,8-dihydroxy-6,7,8,8a-tetrahydro-4H-1,3-benzodioxin-6-yl]-N-octylcarbamate |
|---|---|
| PubChem CID | 142219387 |
| Molecular Formula | C21H38N2O6 |
| Molecular Weight | 414.54 g/mol |
| Exact Mass | 414.27 |
| IUPAC Name | tert-butyl N-[(6R,8aS)-2-amino-7,8-dihydroxy-6,7,8,8a-tetrahydro-4H-1,3-benzodioxin-6-yl]-N-octylcarbamate |
| SMILES | CCCCCCCCN(C(=O)OC(C)(C)C)[C@@H]1C=C2COC(N)O[C@@H]2C(O)C1O |
| InChI | InChI=1S/C21H38N2O6/c1-5-6-7-8-9-10-11-23(20(26)29-21(2,3)4)15-12-14-13-27-19(22)28-18(14)17(25)16(15)24/h12,15-19,24-25H,5-11,13,22H2,1-4H3/t15-,16?,17?,18+,19?/m1/s1 |
| InChIKey | RXFCCKPSWBPJNI-UJPPWBPYSA-N |
| XLogP | 2.27 |
| TPSA | 114.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.54 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|