C25H35ClN2O5 — CID 59134400
tert-butyl N-[(3R,4S)-7-chloro-3-hydroxy-2,2,9-trimethyl-6-oxido-3,4-dihydropyrano[2,3-g]quinolin-6-ium-4-yl]-N-pentylcarbamate (PubChem CID 59134400) has the molecular formula C25H35ClN2O5 and a molecular weight of 479.02 g/mol. Its IUPAC name is tert-butyl N-[(3R,4S)-7-chloro-3-hydroxy-2,2,9-trimethyl-6-oxido-3,4-dihydropyrano[2,3-g]quinolin-6-ium-4-yl]-N-pentylcarbamate.
| Compound Name | tert-butyl N-[(3R,4S)-7-chloro-3-hydroxy-2,2,9-trimethyl-6-oxido-3,4-dihydropyrano[2,3-g]quinolin-6-ium-4-yl]-N-pentylcarbamate |
|---|---|
| PubChem CID | 59134400 |
| Molecular Formula | C25H35ClN2O5 |
| Molecular Weight | 479.02 g/mol |
| Exact Mass | 478.22 |
| IUPAC Name | tert-butyl N-[(3R,4S)-7-chloro-3-hydroxy-2,2,9-trimethyl-6-oxido-3,4-dihydropyrano[2,3-g]quinolin-6-ium-4-yl]-N-pentylcarbamate |
| SMILES | CCCCCN(C(=O)OC(C)(C)C)[C@H]1c2cc3c(cc2OC(C)(C)[C@@H]1O)c(C)cc(Cl)[n+]3[O-] |
| InChI | InChI=1S/C25H35ClN2O5/c1-8-9-10-11-27(23(30)33-24(3,4)5)21-17-13-18-16(15(2)12-20(26)28(18)31)14-19(17)32-25(6,7)22(21)29/h12-14,21-22,29H,8-11H2,1-7H3/t21-,22+/m0/s1 |
| InChIKey | QOVGTRNTWHAHOG-FCHUYYIVSA-N |
| XLogP | 5.44 |
| TPSA | 85.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.02 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|