C24H31ClN2O4 — CID 89093592
tert-butyl N-[(3R,4S)-7-chloro-3-hydroxy-9-methyl-2-methylidene-3,4-dihydropyrano[2,3-g]quinolin-4-yl]-N-pentylcarbamate (PubChem CID 89093592) has the molecular formula C24H31ClN2O4 and a molecular weight of 446.98 g/mol. Its IUPAC name is tert-butyl N-[(3R,4S)-7-chloro-3-hydroxy-9-methyl-2-methylidene-3,4-dihydropyrano[2,3-g]quinolin-4-yl]-N-pentylcarbamate.
| Compound Name | tert-butyl N-[(3R,4S)-7-chloro-3-hydroxy-9-methyl-2-methylidene-3,4-dihydropyrano[2,3-g]quinolin-4-yl]-N-pentylcarbamate |
|---|---|
| PubChem CID | 89093592 |
| Molecular Formula | C24H31ClN2O4 |
| Molecular Weight | 446.98 g/mol |
| Exact Mass | 446.20 |
| IUPAC Name | tert-butyl N-[(3R,4S)-7-chloro-3-hydroxy-9-methyl-2-methylidene-3,4-dihydropyrano[2,3-g]quinolin-4-yl]-N-pentylcarbamate |
| SMILES | C=C1Oc2cc3c(C)cc(Cl)nc3cc2[C@H](N(CCCCC)C(=O)OC(C)(C)C)[C@H]1O |
| InChI | InChI=1S/C24H31ClN2O4/c1-7-8-9-10-27(23(29)31-24(4,5)6)21-17-12-18-16(14(2)11-20(25)26-18)13-19(17)30-15(3)22(21)28/h11-13,21-22,28H,3,7-10H2,1-2,4-6H3/t21-,22-/m0/s1 |
| InChIKey | LDMAWGCGLSBIEG-VXKWHMMOSA-N |
| XLogP | 5.93 |
| TPSA | 71.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.98 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|