C18H31N — CID 142219475
1-cyclohexa-1,5-dien-1-yl-N-[(Z,2E)-2-ethylidenepent-3-enyl]methanimine;ethane (PubChem CID 142219475) has the molecular formula C18H31N and a molecular weight of 261.45 g/mol. Its IUPAC name is 1-cyclohexa-1,5-dien-1-yl-N-[(Z,2E)-2-ethylidenepent-3-enyl]methanimine;ethane.
| Compound Name | 1-cyclohexa-1,5-dien-1-yl-N-[(Z,2E)-2-ethylidenepent-3-enyl]methanimine;ethane |
|---|---|
| PubChem CID | 142219475 |
| Molecular Formula | C18H31N |
| Molecular Weight | 261.45 g/mol |
| Exact Mass | 261.25 |
| IUPAC Name | 1-cyclohexa-1,5-dien-1-yl-N-[(Z,2E)-2-ethylidenepent-3-enyl]methanimine;ethane |
| SMILES | C/C=C\C(=C/C)C/N=C/C1=CCCC=C1.CC.CC |
| InChI | InChI=1S/C14H19N.2C2H6/c1-3-8-13(4-2)11-15-12-14-9-6-5-7-10-14;2*1-2/h3-4,6,8-10,12H,5,7,11H2,1-2H3;2*1-2H3/b8-3-,13-4+,15-12+;; |
| InChIKey | AQYORIRSIZOHOA-ICAYUUNXSA-N |
| XLogP | 5.91 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.45 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|