C19H25NO3 — CID 142220653
3,7-dimethylocta-1,6-dien-3-yl (E)-3-(4-amino-2-hydroxyphenyl)prop-2-enoate (PubChem CID 142220653) has the molecular formula C19H25NO3 and a molecular weight of 315.41 g/mol. Its IUPAC name is 3,7-dimethylocta-1,6-dien-3-yl (E)-3-(4-amino-2-hydroxyphenyl)prop-2-enoate.
| Compound Name | 3,7-dimethylocta-1,6-dien-3-yl (E)-3-(4-amino-2-hydroxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 142220653 |
| Molecular Formula | C19H25NO3 |
| Molecular Weight | 315.41 g/mol |
| Exact Mass | 315.18 |
| IUPAC Name | 3,7-dimethylocta-1,6-dien-3-yl (E)-3-(4-amino-2-hydroxyphenyl)prop-2-enoate |
| SMILES | C=CC(C)(CCC=C(C)C)OC(=O)/C=C/c1ccc(N)cc1O |
| InChI | InChI=1S/C19H25NO3/c1-5-19(4,12-6-7-14(2)3)23-18(22)11-9-15-8-10-16(20)13-17(15)21/h5,7-11,13,21H,1,6,12,20H2,2-4H3/b11-9+ |
| InChIKey | RPLVBNFQUCLSCS-PKNBQFBNSA-N |
| XLogP | 4.22 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.41 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|