C18H24O4 — CID 175228743
3,7-dimethylocta-1,6-dien-3-yl 4-hydroxy-3-methoxybenzoate (PubChem CID 175228743) has the molecular formula C18H24O4 and a molecular weight of 304.39 g/mol. Its IUPAC name is 3,7-dimethylocta-1,6-dien-3-yl 4-hydroxy-3-methoxybenzoate.
| Compound Name | 3,7-dimethylocta-1,6-dien-3-yl 4-hydroxy-3-methoxybenzoate |
|---|---|
| PubChem CID | 175228743 |
| Molecular Formula | C18H24O4 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.17 |
| IUPAC Name | 3,7-dimethylocta-1,6-dien-3-yl 4-hydroxy-3-methoxybenzoate |
| SMILES | C=CC(C)(CCC=C(C)C)OC(=O)c1ccc(O)c(OC)c1 |
| InChI | InChI=1S/C18H24O4/c1-6-18(4,11-7-8-13(2)3)22-17(20)14-9-10-15(19)16(12-14)21-5/h6,8-10,12,19H,1,7,11H2,2-5H3 |
| InChIKey | LUEPYMCEHXEPBW-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|