C19H26O3 — CID 154628458
[(6Z)-3,7-dimethylnona-1,6-dien-3-yl] 4-methoxybenzoate (PubChem CID 154628458) has the molecular formula C19H26O3 and a molecular weight of 302.41 g/mol. Its IUPAC name is [(6Z)-3,7-dimethylnona-1,6-dien-3-yl] 4-methoxybenzoate.
| Compound Name | [(6Z)-3,7-dimethylnona-1,6-dien-3-yl] 4-methoxybenzoate |
|---|---|
| PubChem CID | 154628458 |
| Molecular Formula | C19H26O3 |
| Molecular Weight | 302.41 g/mol |
| Exact Mass | 302.19 |
| IUPAC Name | [(6Z)-3,7-dimethylnona-1,6-dien-3-yl] 4-methoxybenzoate |
| SMILES | C=CC(C)(CC/C=C(/C)CC)OC(=O)c1ccc(OC)cc1 |
| InChI | InChI=1S/C19H26O3/c1-6-15(3)9-8-14-19(4,7-2)22-18(20)16-10-12-17(21-5)13-11-16/h7,9-13H,2,6,8,14H2,1,3-5H3/b15-9- |
| InChIKey | CFHVXVAYVCEPKZ-DHDCSXOGSA-N |
| XLogP | 4.93 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.41 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|