C29H39ClN6O3 — CID 142221589
7-chloro-2-N-[4-[2-[ethyl(methyl)amino]ethyl-methylcarbamoyl]phenyl]-6-[(2Z,4Z)-hepta-2,4-dienyl]-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazine-2,8-dicarboxamide (PubChem CID 142221589) has the molecular formula C29H39ClN6O3 and a molecular weight of 555.12 g/mol. Its IUPAC name is 7-chloro-2-N-[4-[2-[ethyl(methyl)amino]ethyl-methylcarbamoyl]phenyl]-6-[(2Z,4Z)-hepta-2,4-dienyl]-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazine-2,8-dicarboxamide.
| Compound Name | 7-chloro-2-N-[4-[2-[ethyl(methyl)amino]ethyl-methylcarbamoyl]phenyl]-6-[(2Z,4Z)-hepta-2,4-dienyl]-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazine-2,8-dicarboxamide |
|---|---|
| PubChem CID | 142221589 |
| Molecular Formula | C29H39ClN6O3 |
| Molecular Weight | 555.12 g/mol |
| Exact Mass | 554.28 |
| IUPAC Name | 7-chloro-2-N-[4-[2-[ethyl(methyl)amino]ethyl-methylcarbamoyl]phenyl]-6-[(2Z,4Z)-hepta-2,4-dienyl]-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazine-2,8-dicarboxamide |
| SMILES | CC/C=C\C=C/Cc1c(Cl)c(C(N)=O)c2n1CCN(C(=O)Nc1ccc(C(=O)N(C)CCN(C)CC)cc1)C2 |
| InChI | InChI=1S/C29H39ClN6O3/c1-5-7-8-9-10-11-23-26(30)25(27(31)37)24-20-35(18-19-36(23)24)29(39)32-22-14-12-21(13-15-22)28(38)34(4)17-16-33(3)6-2/h7-10,12-15H,5-6,11,16-20H2,1-4H3,(H2,31,37)(H,32,39)/b8-7-,10-9- |
| InChIKey | HJSCPEVQOSKWQP-QRLRYFCNSA-N |
| XLogP | 4.38 |
| TPSA | 103.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.12 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|