C26H36N5O2P — CID 142221621
8-N,7-dimethyl-6-[2-[(Z)-pent-2-en-2-yl]iminoethyl]-2-N-(4-phosphanylphenyl)-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazine-2,8-dicarboxamide;ethene (PubChem CID 142221621) has the molecular formula C26H36N5O2P and a molecular weight of 481.58 g/mol. Its IUPAC name is 8-N,7-dimethyl-6-[2-[(Z)-pent-2-en-2-yl]iminoethyl]-2-N-(4-phosphanylphenyl)-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazine-2,8-dicarboxamide;ethene.
| Compound Name | 8-N,7-dimethyl-6-[2-[(Z)-pent-2-en-2-yl]iminoethyl]-2-N-(4-phosphanylphenyl)-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazine-2,8-dicarboxamide;ethene |
|---|---|
| PubChem CID | 142221621 |
| Molecular Formula | C26H36N5O2P |
| Molecular Weight | 481.58 g/mol |
| Exact Mass | 481.26 |
| IUPAC Name | 8-N,7-dimethyl-6-[2-[(Z)-pent-2-en-2-yl]iminoethyl]-2-N-(4-phosphanylphenyl)-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazine-2,8-dicarboxamide;ethene |
| SMILES | C=C.CC/C=C(C)\N=C\Cc1c(C)c(C(=O)NC)c2n1CCN(C(=O)Nc1ccc(P)cc1)C2 |
| InChI | InChI=1S/C24H32N5O2P.C2H4/c1-5-6-16(2)26-12-11-20-17(3)22(23(30)25-4)21-15-28(13-14-29(20)21)24(31)27-18-7-9-19(32)10-8-18;1-2/h6-10,12H,5,11,13-15,32H2,1-4H3,(H,25,30)(H,27,31);1-2H2/b16-6-,26-12+; |
| InChIKey | CHLNCGOHAKBHMR-QBGMVHLJSA-N |
| XLogP | 4.43 |
| TPSA | 78.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.58 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|