C29H50 — CID 142221652
3-(4,8-dimethyltridecyl)-3,5,6,8-tetramethyl-2,4-dihydro-1H-naphthalene (PubChem CID 142221652) has the molecular formula C29H50 and a molecular weight of 398.72 g/mol. Its IUPAC name is 3-(4,8-dimethyltridecyl)-3,5,6,8-tetramethyl-2,4-dihydro-1H-naphthalene.
| Compound Name | 3-(4,8-dimethyltridecyl)-3,5,6,8-tetramethyl-2,4-dihydro-1H-naphthalene |
|---|---|
| PubChem CID | 142221652 |
| Molecular Formula | C29H50 |
| Molecular Weight | 398.72 g/mol |
| Exact Mass | 398.39 |
| IUPAC Name | 3-(4,8-dimethyltridecyl)-3,5,6,8-tetramethyl-2,4-dihydro-1H-naphthalene |
| SMILES | CCCCCC(C)CCCC(C)CCCC1(C)CCc2c(C)cc(C)c(C)c2C1 |
| InChI | InChI=1S/C29H50/c1-8-9-10-13-22(2)14-11-15-23(3)16-12-18-29(7)19-17-27-25(5)20-24(4)26(6)28(27)21-29/h20,22-23H,8-19,21H2,1-7H3 |
| InChIKey | FNOVXMNENITGEB-UHFFFAOYSA-N |
| XLogP | 9.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.72 |
| LogP ≤ 5 | 9.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|