C31H54 — CID 58937808
(3R)-3,5,6,7,8-pentamethyl-3-[(4R,8R)-4,8,12-trimethyltridecyl]-2,4-dihydro-1H-naphthalene (PubChem CID 58937808) has the molecular formula C31H54 and a molecular weight of 426.77 g/mol. Its IUPAC name is (3R)-3,5,6,7,8-pentamethyl-3-[(4R,8R)-4,8,12-trimethyltridecyl]-2,4-dihydro-1H-naphthalene.
| Compound Name | (3R)-3,5,6,7,8-pentamethyl-3-[(4R,8R)-4,8,12-trimethyltridecyl]-2,4-dihydro-1H-naphthalene |
|---|---|
| PubChem CID | 58937808 |
| Molecular Formula | C31H54 |
| Molecular Weight | 426.77 g/mol |
| Exact Mass | 426.42 |
| IUPAC Name | (3R)-3,5,6,7,8-pentamethyl-3-[(4R,8R)-4,8,12-trimethyltridecyl]-2,4-dihydro-1H-naphthalene |
| SMILES | Cc1c(C)c(C)c2c(c1C)CC[C@@](C)(CCC[C@H](C)CCC[C@H](C)CCCC(C)C)C2 |
| InChI | InChI=1S/C31H54/c1-22(2)13-10-14-23(3)15-11-16-24(4)17-12-19-31(9)20-18-29-27(7)25(5)26(6)28(8)30(29)21-31/h22-24H,10-21H2,1-9H3/t23-,24-,31-/m1/s1 |
| InChIKey | MFGLXMOTYGXUOQ-OVMXQCPESA-N |
| XLogP | 9.85 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.77 |
| LogP ≤ 5 | 9.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |