C30H52O — CID 78020024
1,3,4,6-tetramethyl-6-(4,8,12-trimethyltridecyl)-7,8-dihydro-5H-naphthalen-2-ol (PubChem CID 78020024) has the molecular formula C30H52O and a molecular weight of 428.75 g/mol. Its IUPAC name is 1,3,4,6-tetramethyl-6-(4,8,12-trimethyltridecyl)-7,8-dihydro-5H-naphthalen-2-ol.
| Compound Name | 1,3,4,6-tetramethyl-6-(4,8,12-trimethyltridecyl)-7,8-dihydro-5H-naphthalen-2-ol |
|---|---|
| PubChem CID | 78020024 |
| Molecular Formula | C30H52O |
| Molecular Weight | 428.75 g/mol |
| Exact Mass | 428.40 |
| IUPAC Name | 1,3,4,6-tetramethyl-6-(4,8,12-trimethyltridecyl)-7,8-dihydro-5H-naphthalen-2-ol |
| SMILES | Cc1c(C)c2c(c(C)c1O)CCC(C)(CCCC(C)CCCC(C)CCCC(C)C)C2 |
| InChI | InChI=1S/C30H52O/c1-21(2)12-9-13-22(3)14-10-15-23(4)16-11-18-30(8)19-17-27-26(7)29(31)25(6)24(5)28(27)20-30/h21-23,31H,9-20H2,1-8H3 |
| InChIKey | FPEHLRFQQYVROL-UHFFFAOYSA-N |
| XLogP | 9.25 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.75 |
| LogP ≤ 5 | 9.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |