About 1-methyl-7-methylidene-5,6-dihydro-4H-1,3-diazepine
1-methyl-7-methylidene-5,6-dihydro-4H-1,3-diazepine (PubChem CID 142224397) has the molecular formula C7H12N2
and a molecular weight of 124.19 g/mol. Its IUPAC name is 1-methyl-7-methylidene-5,6-dihydro-4H-1,3-diazepine.
Analyze 1-methyl-7-methylidene-5,6-dihydro-4H-1,3-diazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-7-methylidene-5,6-dihydro-4H-1,3-diazepine?
The IUPAC name of 1-methyl-7-methylidene-5,6-dihydro-4H-1,3-diazepine (CID 142224397) is 1-methyl-7-methylidene-5,6-dihydro-4H-1,3-diazepine.
What is the SMILES notation for 1-methyl-7-methylidene-5,6-dihydro-4H-1,3-diazepine?
The canonical SMILES for 1-methyl-7-methylidene-5,6-dihydro-4H-1,3-diazepine is C=C1CCCN=CN1C.
What is the InChIKey of 1-methyl-7-methylidene-5,6-dihydro-4H-1,3-diazepine?
The InChIKey is NHHSXDQHGBXZFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N2/c1-7-4-3-5-8-6-9(7)2/h6H,1,3-5H2,2H3.
What are the key properties of 1-methyl-7-methylidene-5,6-dihydro-4H-1,3-diazepine?
1-methyl-7-methylidene-5,6-dihydro-4H-1,3-diazepine has a molecular weight of 124.19 g/mol, XLogP of 1.25, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-7-methylidene-5,6-dihydro-4H-1,3-diazepine is sourced from PubChem (CID 142224397), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).