C21H46N2 — CID 142233777
N,2-dimethylbutan-1-amine;ethane;(4Z)-4-ethenyl-N,5-dimethylhepta-4,6-dien-2-amine (PubChem CID 142233777) has the molecular formula C21H46N2 and a molecular weight of 326.61 g/mol. Its IUPAC name is N,2-dimethylbutan-1-amine;ethane;(4Z)-4-ethenyl-N,5-dimethylhepta-4,6-dien-2-amine.
| Compound Name | N,2-dimethylbutan-1-amine;ethane;(4Z)-4-ethenyl-N,5-dimethylhepta-4,6-dien-2-amine |
|---|---|
| PubChem CID | 142233777 |
| Molecular Formula | C21H46N2 |
| Molecular Weight | 326.61 g/mol |
| Exact Mass | 326.37 |
| IUPAC Name | N,2-dimethylbutan-1-amine;ethane;(4Z)-4-ethenyl-N,5-dimethylhepta-4,6-dien-2-amine |
| SMILES | C=C/C(C)=C(\C=C)CC(C)NC.CC.CC.CCC(C)CNC |
| InChI | InChI=1S/C11H19N.C6H15N.2C2H6/c1-6-9(3)11(7-2)8-10(4)12-5;1-4-6(2)5-7-3;2*1-2/h6-7,10,12H,1-2,8H2,3-5H3;6-7H,4-5H2,1-3H3;2*1-2H3/b11-9+;;; |
| InChIKey | NHPQZOKKSQMESN-OOQPXJNPSA-N |
| XLogP | 5.98 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.61 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|