C22H34FN3O3 — CID 142234485
tert-butyl cyclohexanecarboxylate;N-(4-fluorophenyl)piperazine-1-carboxamide (PubChem CID 142234485) has the molecular formula C22H34FN3O3 and a molecular weight of 407.53 g/mol. Its IUPAC name is tert-butyl cyclohexanecarboxylate;N-(4-fluorophenyl)piperazine-1-carboxamide.
| Compound Name | tert-butyl cyclohexanecarboxylate;N-(4-fluorophenyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 142234485 |
| Molecular Formula | C22H34FN3O3 |
| Molecular Weight | 407.53 g/mol |
| Exact Mass | 407.26 |
| IUPAC Name | tert-butyl cyclohexanecarboxylate;N-(4-fluorophenyl)piperazine-1-carboxamide |
| SMILES | CC(C)(C)OC(=O)C1CCCCC1.O=C(Nc1ccc(F)cc1)N1CCNCC1 |
| InChI | InChI=1S/C11H14FN3O.C11H20O2/c12-9-1-3-10(4-2-9)14-11(16)15-7-5-13-6-8-15;1-11(2,3)13-10(12)9-7-5-4-6-8-9/h1-4,13H,5-8H2,(H,14,16);9H,4-8H2,1-3H3 |
| InChIKey | URVSJTYJQWWJPF-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.53 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |